C18H18F3NO3 — CID 126515964
difluoromethyl N-[2-[(4-ethyl-2-methylphenoxy)methyl]-4-fluorophenyl]carbamate (PubChem CID 126515964) has the molecular formula C18H18F3NO3 and a molecular weight of 353.34 g/mol. Its IUPAC name is difluoromethyl N-[2-[(4-ethyl-2-methylphenoxy)methyl]-4-fluorophenyl]carbamate.
| Compound Name | difluoromethyl N-[2-[(4-ethyl-2-methylphenoxy)methyl]-4-fluorophenyl]carbamate |
|---|---|
| PubChem CID | 126515964 |
| Molecular Formula | C18H18F3NO3 |
| Molecular Weight | 353.34 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | difluoromethyl N-[2-[(4-ethyl-2-methylphenoxy)methyl]-4-fluorophenyl]carbamate |
| SMILES | CCc1ccc(OCc2cc(F)ccc2NC(=O)OC(F)F)c(C)c1 |
| InChI | InChI=1S/C18H18F3NO3/c1-3-12-4-7-16(11(2)8-12)24-10-13-9-14(19)5-6-15(13)22-18(23)25-17(20)21/h4-9,17H,3,10H2,1-2H3,(H,22,23) |
| InChIKey | JHOIBNIQDKBGSI-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.34 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |