C19H22INO2 — CID 126588569
N-[2-[(4-ethyl-2-methylphenoxy)methyl]-4-iodophenyl]propanamide (PubChem CID 126588569) has the molecular formula C19H22INO2 and a molecular weight of 423.29 g/mol. Its IUPAC name is N-[2-[(4-ethyl-2-methylphenoxy)methyl]-4-iodophenyl]propanamide.
| Compound Name | N-[2-[(4-ethyl-2-methylphenoxy)methyl]-4-iodophenyl]propanamide |
|---|---|
| PubChem CID | 126588569 |
| Molecular Formula | C19H22INO2 |
| Molecular Weight | 423.29 g/mol |
| Exact Mass | 423.07 |
| IUPAC Name | N-[2-[(4-ethyl-2-methylphenoxy)methyl]-4-iodophenyl]propanamide |
| SMILES | CCC(=O)Nc1ccc(I)cc1COc1ccc(CC)cc1C |
| InChI | InChI=1S/C19H22INO2/c1-4-14-6-9-18(13(3)10-14)23-12-15-11-16(20)7-8-17(15)21-19(22)5-2/h6-11H,4-5,12H2,1-3H3,(H,21,22) |
| InChIKey | CGQHVMBRTMSBIE-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.29 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|