C17H16F2INO3 — CID 129039540
difluoromethyl N-[2-[(2,4-dimethylphenoxy)methyl]-4-iodophenyl]carbamate (PubChem CID 129039540) has the molecular formula C17H16F2INO3 and a molecular weight of 447.22 g/mol. Its IUPAC name is difluoromethyl N-[2-[(2,4-dimethylphenoxy)methyl]-4-iodophenyl]carbamate.
| Compound Name | difluoromethyl N-[2-[(2,4-dimethylphenoxy)methyl]-4-iodophenyl]carbamate |
|---|---|
| PubChem CID | 129039540 |
| Molecular Formula | C17H16F2INO3 |
| Molecular Weight | 447.22 g/mol |
| Exact Mass | 447.01 |
| IUPAC Name | difluoromethyl N-[2-[(2,4-dimethylphenoxy)methyl]-4-iodophenyl]carbamate |
| SMILES | Cc1ccc(OCc2cc(I)ccc2NC(=O)OC(F)F)c(C)c1 |
| InChI | InChI=1S/C17H16F2INO3/c1-10-3-6-15(11(2)7-10)23-9-12-8-13(20)4-5-14(12)21-17(22)24-16(18)19/h3-8,16H,9H2,1-2H3,(H,21,22) |
| InChIKey | YAWAYICUTOIFLC-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.22 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|