C19H16ClF3O2 — CID 121367503
3-cyclopropyl-2-[[4-methyl-2-(trifluoromethyl)phenoxy]methyl]benzoyl chloride (PubChem CID 121367503) has the molecular formula C19H16ClF3O2 and a molecular weight of 368.78 g/mol. Its IUPAC name is 3-cyclopropyl-2-[[4-methyl-2-(trifluoromethyl)phenoxy]methyl]benzoyl chloride.
| Compound Name | 3-cyclopropyl-2-[[4-methyl-2-(trifluoromethyl)phenoxy]methyl]benzoyl chloride |
|---|---|
| PubChem CID | 121367503 |
| Molecular Formula | C19H16ClF3O2 |
| Molecular Weight | 368.78 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | 3-cyclopropyl-2-[[4-methyl-2-(trifluoromethyl)phenoxy]methyl]benzoyl chloride |
| SMILES | Cc1ccc(OCc2c(C(=O)Cl)cccc2C2CC2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H16ClF3O2/c1-11-5-8-17(16(9-11)19(21,22)23)25-10-15-13(12-6-7-12)3-2-4-14(15)18(20)24/h2-5,8-9,12H,6-7,10H2,1H3 |
| InChIKey | GHITUJPIPXCOAO-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.78 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|