C18H19FO5 — CID 122645469
[3-ethoxy-2-[(3-fluoro-4-methylphenoxy)methyl]phenyl] methyl carbonate (PubChem CID 122645469) has the molecular formula C18H19FO5 and a molecular weight of 334.34 g/mol. Its IUPAC name is [3-ethoxy-2-[(3-fluoro-4-methylphenoxy)methyl]phenyl] methyl carbonate.
| Compound Name | [3-ethoxy-2-[(3-fluoro-4-methylphenoxy)methyl]phenyl] methyl carbonate |
|---|---|
| PubChem CID | 122645469 |
| Molecular Formula | C18H19FO5 |
| Molecular Weight | 334.34 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | [3-ethoxy-2-[(3-fluoro-4-methylphenoxy)methyl]phenyl] methyl carbonate |
| SMILES | CCOc1cccc(OC(=O)OC)c1COc1ccc(C)c(F)c1 |
| InChI | InChI=1S/C18H19FO5/c1-4-22-16-6-5-7-17(24-18(20)21-3)14(16)11-23-13-9-8-12(2)15(19)10-13/h5-10H,4,11H2,1-3H3 |
| InChIKey | WGBUIFIDEFSZHR-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.34 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|