C17H17IO4 — CID 122645669
[2-[(3,4-dimethylphenoxy)methyl]-3-iodophenyl] methyl carbonate (PubChem CID 122645669) has the molecular formula C17H17IO4 and a molecular weight of 412.22 g/mol. Its IUPAC name is [2-[(3,4-dimethylphenoxy)methyl]-3-iodophenyl] methyl carbonate.
| Compound Name | [2-[(3,4-dimethylphenoxy)methyl]-3-iodophenyl] methyl carbonate |
|---|---|
| PubChem CID | 122645669 |
| Molecular Formula | C17H17IO4 |
| Molecular Weight | 412.22 g/mol |
| Exact Mass | 412.02 |
| IUPAC Name | [2-[(3,4-dimethylphenoxy)methyl]-3-iodophenyl] methyl carbonate |
| SMILES | COC(=O)Oc1cccc(I)c1COc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C17H17IO4/c1-11-7-8-13(9-12(11)2)21-10-14-15(18)5-4-6-16(14)22-17(19)20-3/h4-9H,10H2,1-3H3 |
| InChIKey | KPGXBDHJYCAYIK-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.22 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|