About 1-methoxy-4-phenoxybenzene;2-methylpiperidine
1-methoxy-4-phenoxybenzene;2-methylpiperidine (PubChem CID 143435374) has the molecular formula C19H25NO2
and a molecular weight of 299.41 g/mol. Its IUPAC name is 1-methoxy-4-phenoxybenzene;2-methylpiperidine.
Molecular Properties
| Compound Name | 1-methoxy-4-phenoxybenzene;2-methylpiperidine |
| PubChem CID | 143435374 |
| Molecular Formula | C19H25NO2 |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 299.19 |
| IUPAC Name | 1-methoxy-4-phenoxybenzene;2-methylpiperidine |
| SMILES | CC1CCCCN1.COc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C13H12O2.C6H13N/c1-14-11-7-9-13(10-8-11)15-12-5-3-2-4-6-12;1-6-4-2-3-5-7-6/h2-10H,1H3;6-7H,2-5H2,1H3 |
| InChIKey | YIOBJQVDIKKKPN-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-methoxy-4-phenoxybenzene;2-methylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxy-4-phenoxybenzene;2-methylpiperidine?
The IUPAC name of 1-methoxy-4-phenoxybenzene;2-methylpiperidine (CID 143435374) is 1-methoxy-4-phenoxybenzene;2-methylpiperidine.
What is the SMILES notation for 1-methoxy-4-phenoxybenzene;2-methylpiperidine?
The canonical SMILES for 1-methoxy-4-phenoxybenzene;2-methylpiperidine is CC1CCCCN1.COc1ccc(Oc2ccccc2)cc1.
What is the InChIKey of 1-methoxy-4-phenoxybenzene;2-methylpiperidine?
The InChIKey is YIOBJQVDIKKKPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12O2.C6H13N/c1-14-11-7-9-13(10-8-11)15-12-5-3-2-4-6-12;1-6-4-2-3-5-7-6/h2-10H,1H3;6-7H,2-5H2,1H3.
What are the key properties of 1-methoxy-4-phenoxybenzene;2-methylpiperidine?
1-methoxy-4-phenoxybenzene;2-methylpiperidine has a molecular weight of 299.41 g/mol, XLogP of 4.64, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxy-4-phenoxybenzene;2-methylpiperidine is sourced from PubChem (CID 143435374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).