About (2S)-2-methylpiperidine;(2S)-2-methylpyrrolidine
(2S)-2-methylpiperidine;(2S)-2-methylpyrrolidine (PubChem CID 164977059) has the molecular formula C11H24N2
and a molecular weight of 184.33 g/mol. Its IUPAC name is (2S)-2-methylpiperidine;(2S)-2-methylpyrrolidine.
Molecular Properties
| Compound Name | (2S)-2-methylpiperidine;(2S)-2-methylpyrrolidine |
| PubChem CID | 164977059 |
| Molecular Formula | C11H24N2 |
| Molecular Weight | 184.33 g/mol |
| Exact Mass | 184.19 |
| IUPAC Name | (2S)-2-methylpiperidine;(2S)-2-methylpyrrolidine |
| SMILES | C[C@H]1CCCCN1.C[C@H]1CCCN1 |
| InChI | InChI=1S/C6H13N.C5H11N/c1-6-4-2-3-5-7-6;1-5-3-2-4-6-5/h6-7H,2-5H2,1H3;5-6H,2-4H2,1H3/t6-;5-/m00/s1 |
| InChIKey | DXYSLHHIPWOZAO-MENMJLHVSA-N |
| XLogP | 1.91 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.33 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-2-methylpiperidine;(2S)-2-methylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-methylpiperidine;(2S)-2-methylpyrrolidine?
The IUPAC name of (2S)-2-methylpiperidine;(2S)-2-methylpyrrolidine (CID 164977059) is (2S)-2-methylpiperidine;(2S)-2-methylpyrrolidine.
What is the SMILES notation for (2S)-2-methylpiperidine;(2S)-2-methylpyrrolidine?
The canonical SMILES for (2S)-2-methylpiperidine;(2S)-2-methylpyrrolidine is C[C@H]1CCCCN1.C[C@H]1CCCN1.
What is the InChIKey of (2S)-2-methylpiperidine;(2S)-2-methylpyrrolidine?
The InChIKey is DXYSLHHIPWOZAO-MENMJLHVSA-N. The full InChI is InChI=1S/C6H13N.C5H11N/c1-6-4-2-3-5-7-6;1-5-3-2-4-6-5/h6-7H,2-5H2,1H3;5-6H,2-4H2,1H3/t6-;5-/m00/s1.
What are the key properties of (2S)-2-methylpiperidine;(2S)-2-methylpyrrolidine?
(2S)-2-methylpiperidine;(2S)-2-methylpyrrolidine has a molecular weight of 184.33 g/mol, XLogP of 1.91, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-methylpiperidine;(2S)-2-methylpyrrolidine is sourced from PubChem (CID 164977059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).