C10H19NO6 — CID 21041485
2,3-dihydroxybutanedioic acid;(2R)-2-methylpiperidine (PubChem CID 21041485) has the molecular formula C10H19NO6 and a molecular weight of 249.26 g/mol. Its IUPAC name is 2,3-dihydroxybutanedioic acid;(2R)-2-methylpiperidine.
| Compound Name | 2,3-dihydroxybutanedioic acid;(2R)-2-methylpiperidine |
|---|---|
| PubChem CID | 21041485 |
| Molecular Formula | C10H19NO6 |
| Molecular Weight | 249.26 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | 2,3-dihydroxybutanedioic acid;(2R)-2-methylpiperidine |
| SMILES | C[C@@H]1CCCCN1.O=C(O)C(O)C(O)C(=O)O |
| InChI | InChI=1S/C6H13N.C4H6O6/c1-6-4-2-3-5-7-6;5-1(3(7)8)2(6)4(9)10/h6-7H,2-5H2,1H3;1-2,5-6H,(H,7,8)(H,9,10)/t6-;/m1./s1 |
| InChIKey | LMABJXMUDFOITG-FYZOBXCZSA-N |
| XLogP | -0.97 |
| TPSA | 127.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.26 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |