C14H26N2O6 — CID 70262057
(2R,3R)-2,3-dihydroxybutanedioic acid;2-piperidin-2-ylpiperidine (PubChem CID 70262057) has the molecular formula C14H26N2O6 and a molecular weight of 318.37 g/mol. Its IUPAC name is (2R,3R)-2,3-dihydroxybutanedioic acid;2-piperidin-2-ylpiperidine.
| Compound Name | (2R,3R)-2,3-dihydroxybutanedioic acid;2-piperidin-2-ylpiperidine |
|---|---|
| PubChem CID | 70262057 |
| Molecular Formula | C14H26N2O6 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | (2R,3R)-2,3-dihydroxybutanedioic acid;2-piperidin-2-ylpiperidine |
| SMILES | C1CCC(C2CCCCN2)NC1.O=C(O)[C@H](O)[C@@H](O)C(=O)O |
| InChI | InChI=1S/C10H20N2.C4H6O6/c1-3-7-11-9(5-1)10-6-2-4-8-12-10;5-1(3(7)8)2(6)4(9)10/h9-12H,1-8H2;1-2,5-6H,(H,7,8)(H,9,10)/t;1-,2-/m.1/s1 |
| InChIKey | NHMSJUHYMQOVBO-LREBCSMRSA-N |
| XLogP | -0.85 |
| TPSA | 139.12 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |