C18H21NO2 — CID 68769138
1-(4-phenoxyphenyl)-1-pyrrolidin-2-ylethanol (PubChem CID 68769138) has the molecular formula C18H21NO2 and a molecular weight of 283.37 g/mol. Its IUPAC name is 1-(4-phenoxyphenyl)-1-pyrrolidin-2-ylethanol.
| Compound Name | 1-(4-phenoxyphenyl)-1-pyrrolidin-2-ylethanol |
|---|---|
| PubChem CID | 68769138 |
| Molecular Formula | C18H21NO2 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | 1-(4-phenoxyphenyl)-1-pyrrolidin-2-ylethanol |
| SMILES | CC(O)(c1ccc(Oc2ccccc2)cc1)C1CCCN1 |
| InChI | InChI=1S/C18H21NO2/c1-18(20,17-8-5-13-19-17)14-9-11-16(12-10-14)21-15-6-3-2-4-7-15/h2-4,6-7,9-12,17,19-20H,5,8,13H2,1H3 |
| InChIKey | FQDMLKQKNBNTHY-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |