C23H37NO2Si2 — CID 138393439
diphenyl-[(2S)-pyrrolidin-2-yl]methanol;trimethyl(trimethylsilyloxy)silane (PubChem CID 138393439) has the molecular formula C23H37NO2Si2 and a molecular weight of 415.73 g/mol. Its IUPAC name is diphenyl-[(2S)-pyrrolidin-2-yl]methanol;trimethyl(trimethylsilyloxy)silane.
| Compound Name | diphenyl-[(2S)-pyrrolidin-2-yl]methanol;trimethyl(trimethylsilyloxy)silane |
|---|---|
| PubChem CID | 138393439 |
| Molecular Formula | C23H37NO2Si2 |
| Molecular Weight | 415.73 g/mol |
| Exact Mass | 415.24 |
| IUPAC Name | diphenyl-[(2S)-pyrrolidin-2-yl]methanol;trimethyl(trimethylsilyloxy)silane |
| SMILES | C[Si](C)(C)O[Si](C)(C)C.OC(c1ccccc1)(c1ccccc1)[C@@H]1CCCN1 |
| InChI | InChI=1S/C17H19NO.C6H18OSi2/c19-17(16-12-7-13-18-16,14-8-3-1-4-9-14)15-10-5-2-6-11-15;1-8(2,3)7-9(4,5)6/h1-6,8-11,16,18-19H,7,12-13H2;1-6H3/t16-;/m0./s1 |
| InChIKey | DOEVTFOBODVBJM-NTISSMGPSA-N |
| XLogP | 5.35 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.73 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|