C30H31NSi — CID 177493486
[diphenyl-[(2S)-pyrrolidin-2-yl]methyl]-methyl-diphenylsilane (PubChem CID 177493486) has the molecular formula C30H31NSi and a molecular weight of 433.67 g/mol. Its IUPAC name is [diphenyl-[(2S)-pyrrolidin-2-yl]methyl]-methyl-diphenylsilane.
| Compound Name | [diphenyl-[(2S)-pyrrolidin-2-yl]methyl]-methyl-diphenylsilane |
|---|---|
| PubChem CID | 177493486 |
| Molecular Formula | C30H31NSi |
| Molecular Weight | 433.67 g/mol |
| Exact Mass | 433.22 |
| IUPAC Name | [diphenyl-[(2S)-pyrrolidin-2-yl]methyl]-methyl-diphenylsilane |
| SMILES | C[Si](c1ccccc1)(c1ccccc1)C(c1ccccc1)(c1ccccc1)[C@@H]1CCCN1 |
| InChI | InChI=1S/C30H31NSi/c1-32(27-19-10-4-11-20-27,28-21-12-5-13-22-28)30(29-23-14-24-31-29,25-15-6-2-7-16-25)26-17-8-3-9-18-26/h2-13,15-22,29,31H,14,23-24H2,1H3/t29-/m0/s1 |
| InChIKey | ZIWHXZZEOHPFNR-LJAQVGFWSA-N |
| XLogP | 5.16 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.67 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|