C17H19BNO — CID 19782534
alpha,alpha-Diphenyl-2-pyrrolidinemethanol borane (PubChem CID 19782534) has the molecular formula C17H19BNO and a molecular weight of 264.16 g/mol.
| Compound Name | alpha,alpha-Diphenyl-2-pyrrolidinemethanol borane |
|---|---|
| PubChem CID | 19782534 |
| Molecular Formula | C17H19BNO |
| Molecular Weight | 264.16 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | — |
| SMILES | OC(c1ccccc1)(c1ccccc1)C1CCCN1.[B] |
| InChI | InChI=1S/C17H19NO.B/c19-17(16-12-7-13-18-16,14-8-3-1-4-9-14)15-10-5-2-6-11-15;/h1-6,8-11,16,18-19H,7,12-13H2; |
| InChIKey | ZOYBWQYADSMRHP-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.16 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|