C41H35NO — CID 59628921
bis(3,5-diphenylphenyl)-[(2R)-pyrrolidin-2-yl]methanol (PubChem CID 59628921) has the molecular formula C41H35NO and a molecular weight of 557.74 g/mol. Its IUPAC name is bis(3,5-diphenylphenyl)-[(2R)-pyrrolidin-2-yl]methanol.
| Compound Name | bis(3,5-diphenylphenyl)-[(2R)-pyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 59628921 |
| Molecular Formula | C41H35NO |
| Molecular Weight | 557.74 g/mol |
| Exact Mass | 557.27 |
| IUPAC Name | bis(3,5-diphenylphenyl)-[(2R)-pyrrolidin-2-yl]methanol |
| SMILES | OC(c1cc(-c2ccccc2)cc(-c2ccccc2)c1)(c1cc(-c2ccccc2)cc(-c2ccccc2)c1)[C@H]1CCCN1 |
| InChI | InChI=1S/C41H35NO/c43-41(40-22-13-23-42-40,38-26-34(30-14-5-1-6-15-30)24-35(27-38)31-16-7-2-8-17-31)39-28-36(32-18-9-3-10-19-32)25-37(29-39)33-20-11-4-12-21-33/h1-12,14-21,24-29,40,42-43H,13,22-23H2/t40-/m1/s1 |
| InChIKey | BBMBNOOMBRYEOI-RRHRGVEJSA-N |
| XLogP | 9.34 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.74 |
| LogP ≤ 5 | 9.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |