C25H35NO2 — CID 15978835
(E)-N-(2-phenoxyethoxy)-1-[(1R,2R,7S,9S)-3,3,7-trimethyl-8-tricyclo[5.4.0.02,9]undecanylidene]propan-2-imine (PubChem CID 15978835) has the molecular formula C25H35NO2 and a molecular weight of 381.56 g/mol. Its IUPAC name is (E)-N-(2-phenoxyethoxy)-1-[(1R,2R,7S,9S)-3,3,7-trimethyl-8-tricyclo[5.4.0.02,9]undecanylidene]propan-2-imine.
| Compound Name | (E)-N-(2-phenoxyethoxy)-1-[(1R,2R,7S,9S)-3,3,7-trimethyl-8-tricyclo[5.4.0.02,9]undecanylidene]propan-2-imine |
|---|---|
| PubChem CID | 15978835 |
| Molecular Formula | C25H35NO2 |
| Molecular Weight | 381.56 g/mol |
| Exact Mass | 381.27 |
| IUPAC Name | (E)-N-(2-phenoxyethoxy)-1-[(1R,2R,7S,9S)-3,3,7-trimethyl-8-tricyclo[5.4.0.02,9]undecanylidene]propan-2-imine |
| SMILES | C/C(C=C1[C@H]2CC[C@@H]3[C@H]2C(C)(C)CCC[C@]13C)=N\OCCOc1ccccc1 |
| InChI | InChI=1S/C25H35NO2/c1-18(26-28-16-15-27-19-9-6-5-7-10-19)17-22-20-11-12-21-23(20)24(2,3)13-8-14-25(21,22)4/h5-7,9-10,17,20-21,23H,8,11-16H2,1-4H3/b22-17?,26-18+/t20-,21-,23+,25+/m1/s1 |
| InChIKey | LQGLSSKVCCLCSP-WGWCCYHMSA-N |
| XLogP | 6.26 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.56 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|