C14H22O2 — CID 71524146
(1R,2R,6R,7R,9S)-6-hydroxy-3,3,7-trimethyltricyclo[5.4.0.02,9]undecan-8-one (PubChem CID 71524146) has the molecular formula C14H22O2 and a molecular weight of 222.33 g/mol. Its IUPAC name is (1R,2R,6R,7R,9S)-6-hydroxy-3,3,7-trimethyltricyclo[5.4.0.02,9]undecan-8-one.
| Compound Name | (1R,2R,6R,7R,9S)-6-hydroxy-3,3,7-trimethyltricyclo[5.4.0.02,9]undecan-8-one |
|---|---|
| PubChem CID | 71524146 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | (1R,2R,6R,7R,9S)-6-hydroxy-3,3,7-trimethyltricyclo[5.4.0.02,9]undecan-8-one |
| SMILES | CC1(C)CC[C@@H](O)[C@]2(C)C(=O)[C@H]3CC[C@@H]2[C@H]31 |
| InChI | InChI=1S/C14H22O2/c1-13(2)7-6-10(15)14(3)9-5-4-8(11(9)13)12(14)16/h8-11,15H,4-7H2,1-3H3/t8-,9+,10+,11-,14+/m0/s1 |
| InChIKey | RHPIARQBSTZNCU-FPFACLPRSA-N |
| XLogP | 2.40 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |