C20H30O2 — CID 154715767
(14R)-8-hydroxy-5,5,9,14-tetramethyltetracyclo[11.2.1.01,10.04,9]hexadec-10-en-12-one (PubChem CID 154715767) has the molecular formula C20H30O2 and a molecular weight of 302.46 g/mol. Its IUPAC name is (14R)-8-hydroxy-5,5,9,14-tetramethyltetracyclo[11.2.1.01,10.04,9]hexadec-10-en-12-one.
| Compound Name | (14R)-8-hydroxy-5,5,9,14-tetramethyltetracyclo[11.2.1.01,10.04,9]hexadec-10-en-12-one |
|---|---|
| PubChem CID | 154715767 |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | (14R)-8-hydroxy-5,5,9,14-tetramethyltetracyclo[11.2.1.01,10.04,9]hexadec-10-en-12-one |
| SMILES | C[C@@H]1CC23CCC4C(C)(C)CCC(O)C4(C)C2=CC(=O)C1C3 |
| InChI | InChI=1S/C20H30O2/c1-12-10-20-8-5-15-18(2,3)7-6-17(22)19(15,4)16(20)9-14(21)13(12)11-20/h9,12-13,15,17,22H,5-8,10-11H2,1-4H3/t12-,13?,15?,17?,19?,20?/m1/s1 |
| InChIKey | OMLXKAWHBVPCQQ-ZNJWSZRTSA-N |
| XLogP | 4.13 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |