C18H24O4 — CID 91138576
(4R,4aS)-4,8-dihydroxy-7-methoxy-1,1,4a-trimethyl-3,4,10,10a-tetrahydro-2H-phenanthren-9-one (PubChem CID 91138576) has the molecular formula C18H24O4 and a molecular weight of 304.39 g/mol. Its IUPAC name is (4R,4aS)-4,8-dihydroxy-7-methoxy-1,1,4a-trimethyl-3,4,10,10a-tetrahydro-2H-phenanthren-9-one.
| Compound Name | (4R,4aS)-4,8-dihydroxy-7-methoxy-1,1,4a-trimethyl-3,4,10,10a-tetrahydro-2H-phenanthren-9-one |
|---|---|
| PubChem CID | 91138576 |
| Molecular Formula | C18H24O4 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | (4R,4aS)-4,8-dihydroxy-7-methoxy-1,1,4a-trimethyl-3,4,10,10a-tetrahydro-2H-phenanthren-9-one |
| SMILES | COc1ccc2c(c1O)C(=O)CC1C(C)(C)CC[C@@H](O)[C@]21C |
| InChI | InChI=1S/C18H24O4/c1-17(2)8-7-14(20)18(3)10-5-6-12(22-4)16(21)15(10)11(19)9-13(17)18/h5-6,13-14,20-21H,7-9H2,1-4H3/t13?,14-,18-/m1/s1 |
| InChIKey | GQMNWJSFCVRPJU-JDPNFYKBSA-N |
| XLogP | 3.04 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |