C17H22O4 — CID 163115438
2,6,7-trihydroxy-1,1,4a-trimethyl-3,4,10,10a-tetrahydro-2H-phenanthren-9-one (PubChem CID 163115438) has the molecular formula C17H22O4 and a molecular weight of 290.36 g/mol. Its IUPAC name is 2,6,7-trihydroxy-1,1,4a-trimethyl-3,4,10,10a-tetrahydro-2H-phenanthren-9-one.
| Compound Name | 2,6,7-trihydroxy-1,1,4a-trimethyl-3,4,10,10a-tetrahydro-2H-phenanthren-9-one |
|---|---|
| PubChem CID | 163115438 |
| Molecular Formula | C17H22O4 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 2,6,7-trihydroxy-1,1,4a-trimethyl-3,4,10,10a-tetrahydro-2H-phenanthren-9-one |
| SMILES | CC12CCC(O)C(C)(C)C1CC(=O)c1cc(O)c(O)cc12 |
| InChI | InChI=1S/C17H22O4/c1-16(2)14-8-11(18)9-6-12(19)13(20)7-10(9)17(14,3)5-4-15(16)21/h6-7,14-15,19-21H,4-5,8H2,1-3H3 |
| InChIKey | XRAYDQRKGATMIV-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|