C20H30O2 — CID 163002569
1,1,4a-trimethyl-6-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-2,7-diol (PubChem CID 163002569) has the molecular formula C20H30O2 and a molecular weight of 302.46 g/mol. Its IUPAC name is 1,1,4a-trimethyl-6-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-2,7-diol.
| Compound Name | 1,1,4a-trimethyl-6-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-2,7-diol |
|---|---|
| PubChem CID | 163002569 |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | 1,1,4a-trimethyl-6-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-2,7-diol |
| SMILES | CC(C)c1cc2c(cc1O)CCC1C2(C)CCC(O)C1(C)C |
| InChI | InChI=1S/C20H30O2/c1-12(2)14-11-15-13(10-16(14)21)6-7-17-19(3,4)18(22)8-9-20(15,17)5/h10-12,17-18,21-22H,6-9H2,1-5H3 |
| InChIKey | CYCUDJXIJBGDKE-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |