C23H38OSi — CID 91743369
(4b,8,8-trimethyl-3-propan-2-yl-5,6,7,8a,9,10-hexahydrophenanthren-2-yl)oxy-trimethylsilane (PubChem CID 91743369) has the molecular formula C23H38OSi and a molecular weight of 358.64 g/mol. Its IUPAC name is (4b,8,8-trimethyl-3-propan-2-yl-5,6,7,8a,9,10-hexahydrophenanthren-2-yl)oxy-trimethylsilane.
| Compound Name | (4b,8,8-trimethyl-3-propan-2-yl-5,6,7,8a,9,10-hexahydrophenanthren-2-yl)oxy-trimethylsilane |
|---|---|
| PubChem CID | 91743369 |
| Molecular Formula | C23H38OSi |
| Molecular Weight | 358.64 g/mol |
| Exact Mass | 358.27 |
| IUPAC Name | (4b,8,8-trimethyl-3-propan-2-yl-5,6,7,8a,9,10-hexahydrophenanthren-2-yl)oxy-trimethylsilane |
| SMILES | CC(C)c1cc2c(cc1O[Si](C)(C)C)CCC1C(C)(C)CCCC21C |
| InChI | InChI=1S/C23H38OSi/c1-16(2)18-15-19-17(14-20(18)24-25(6,7)8)10-11-21-22(3,4)12-9-13-23(19,21)5/h14-16,21H,9-13H2,1-8H3 |
| InChIKey | YOJRUCFZKUVCKD-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.64 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|