C18H26O — CID 10515391
(4bS,8aS)-2,4b,8,8-tetramethyl-5,6,7,8a,9,10-hexahydrophenanthren-3-ol (PubChem CID 10515391) has the molecular formula C18H26O and a molecular weight of 258.40 g/mol. Its IUPAC name is (4bS,8aS)-2,4b,8,8-tetramethyl-5,6,7,8a,9,10-hexahydrophenanthren-3-ol.
| Compound Name | (4bS,8aS)-2,4b,8,8-tetramethyl-5,6,7,8a,9,10-hexahydrophenanthren-3-ol |
|---|---|
| PubChem CID | 10515391 |
| Molecular Formula | C18H26O |
| Molecular Weight | 258.40 g/mol |
| Exact Mass | 258.20 |
| IUPAC Name | (4bS,8aS)-2,4b,8,8-tetramethyl-5,6,7,8a,9,10-hexahydrophenanthren-3-ol |
| SMILES | Cc1cc2c(cc1O)[C@@]1(C)CCCC(C)(C)[C@@H]1CC2 |
| InChI | InChI=1S/C18H26O/c1-12-10-13-6-7-16-17(2,3)8-5-9-18(16,4)14(13)11-15(12)19/h10-11,16,19H,5-9H2,1-4H3/t16-,18+/m0/s1 |
| InChIKey | ODTCMDWMTYIADH-FUHWJXTLSA-N |
| XLogP | 4.73 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.40 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |