C19H28O2 — CID 95561924
[(1S,4aR,10aR)-6-methoxy-1,4a,7-trimethyl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methanol (PubChem CID 95561924) has the molecular formula C19H28O2 and a molecular weight of 288.43 g/mol. Its IUPAC name is [(1S,4aR,10aR)-6-methoxy-1,4a,7-trimethyl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methanol.
| Compound Name | [(1S,4aR,10aR)-6-methoxy-1,4a,7-trimethyl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methanol |
|---|---|
| PubChem CID | 95561924 |
| Molecular Formula | C19H28O2 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | [(1S,4aR,10aR)-6-methoxy-1,4a,7-trimethyl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methanol |
| SMILES | COc1cc2c(cc1C)CC[C@H]1[C@@](C)(CO)CCC[C@@]21C |
| InChI | InChI=1S/C19H28O2/c1-13-10-14-6-7-17-18(2,12-20)8-5-9-19(17,3)15(14)11-16(13)21-4/h10-11,17,20H,5-9,12H2,1-4H3/t17-,18+,19-/m0/s1 |
| InChIKey | BRYNUXHFBWXOMT-OTWHNJEPSA-N |
| XLogP | 4.01 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |