C18H26O2 — CID 15870443
(4bS,8aS)-2-methoxy-4b,8,8-trimethyl-5,6,7,8a,9,10-hexahydrophenanthren-3-ol (PubChem CID 15870443) has the molecular formula C18H26O2 and a molecular weight of 274.40 g/mol. Its IUPAC name is (4bS,8aS)-2-methoxy-4b,8,8-trimethyl-5,6,7,8a,9,10-hexahydrophenanthren-3-ol.
| Compound Name | (4bS,8aS)-2-methoxy-4b,8,8-trimethyl-5,6,7,8a,9,10-hexahydrophenanthren-3-ol |
|---|---|
| PubChem CID | 15870443 |
| Molecular Formula | C18H26O2 |
| Molecular Weight | 274.40 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | (4bS,8aS)-2-methoxy-4b,8,8-trimethyl-5,6,7,8a,9,10-hexahydrophenanthren-3-ol |
| SMILES | COc1cc2c(cc1O)[C@@]1(C)CCCC(C)(C)[C@@H]1CC2 |
| InChI | InChI=1S/C18H26O2/c1-17(2)8-5-9-18(3)13-11-14(19)15(20-4)10-12(13)6-7-16(17)18/h10-11,16,19H,5-9H2,1-4H3/t16-,18+/m0/s1 |
| InChIKey | SIQSVCRIJUURID-FUHWJXTLSA-N |
| XLogP | 4.43 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.40 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |