C24H30O2 — CID 638504
(4bR,8aR)-4b,8,8-trimethyl-3-phenylmethoxy-5,6,7,8a,9,10-hexahydrophenanthren-2-ol (PubChem CID 638504) has the molecular formula C24H30O2 and a molecular weight of 350.50 g/mol. Its IUPAC name is (4bR,8aR)-4b,8,8-trimethyl-3-phenylmethoxy-5,6,7,8a,9,10-hexahydrophenanthren-2-ol.
| Compound Name | (4bR,8aR)-4b,8,8-trimethyl-3-phenylmethoxy-5,6,7,8a,9,10-hexahydrophenanthren-2-ol |
|---|---|
| PubChem CID | 638504 |
| Molecular Formula | C24H30O2 |
| Molecular Weight | 350.50 g/mol |
| Exact Mass | 350.22 |
| IUPAC Name | (4bR,8aR)-4b,8,8-trimethyl-3-phenylmethoxy-5,6,7,8a,9,10-hexahydrophenanthren-2-ol |
| SMILES | CC1(C)CCC[C@@]2(C)c3cc(OCc4ccccc4)c(O)cc3CC[C@H]12 |
| InChI | InChI=1S/C24H30O2/c1-23(2)12-7-13-24(3)19-15-21(26-16-17-8-5-4-6-9-17)20(25)14-18(19)10-11-22(23)24/h4-6,8-9,14-15,22,25H,7,10-13,16H2,1-3H3/t22-,24+/m1/s1 |
| InChIKey | ZRADIGZVMZYRSY-VWNXMTODSA-N |
| XLogP | 6.00 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.50 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |