C31H35NO2 — CID 146256490
(1S)-6-(dibenzylamino)-1,4a-dimethyl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid (PubChem CID 146256490) has the molecular formula C31H35NO2 and a molecular weight of 453.63 g/mol. Its IUPAC name is (1S)-6-(dibenzylamino)-1,4a-dimethyl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid.
| Compound Name | (1S)-6-(dibenzylamino)-1,4a-dimethyl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid |
|---|---|
| PubChem CID | 146256490 |
| Molecular Formula | C31H35NO2 |
| Molecular Weight | 453.63 g/mol |
| Exact Mass | 453.27 |
| IUPAC Name | (1S)-6-(dibenzylamino)-1,4a-dimethyl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid |
| SMILES | CC12CCC[C@](C)(C(=O)O)C1CCc1ccc(N(Cc3ccccc3)Cc3ccccc3)cc12 |
| InChI | InChI=1S/C31H35NO2/c1-30-18-9-19-31(2,29(33)34)28(30)17-15-25-14-16-26(20-27(25)30)32(21-23-10-5-3-6-11-23)22-24-12-7-4-8-13-24/h3-8,10-14,16,20,28H,9,15,17-19,21-22H2,1-2H3,(H,33,34)/t28?,30?,31-/m0/s1 |
| InChIKey | RGMPSMXDPILJOK-YTXJACINSA-N |
| XLogP | 6.99 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.63 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |