C17H24O2 — CID 24746671
(4bS)-4b,8,8-trimethyl-5,6,7,8a,9,10-hexahydrophenanthrene-2,3-diol (PubChem CID 24746671) has the molecular formula C17H24O2 and a molecular weight of 260.38 g/mol. Its IUPAC name is (4bS)-4b,8,8-trimethyl-5,6,7,8a,9,10-hexahydrophenanthrene-2,3-diol.
| Compound Name | (4bS)-4b,8,8-trimethyl-5,6,7,8a,9,10-hexahydrophenanthrene-2,3-diol |
|---|---|
| PubChem CID | 24746671 |
| Molecular Formula | C17H24O2 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | (4bS)-4b,8,8-trimethyl-5,6,7,8a,9,10-hexahydrophenanthrene-2,3-diol |
| SMILES | CC1(C)CCC[C@]2(C)c3cc(O)c(O)cc3CCC12 |
| InChI | InChI=1S/C17H24O2/c1-16(2)7-4-8-17(3)12-10-14(19)13(18)9-11(12)5-6-15(16)17/h9-10,15,18-19H,4-8H2,1-3H3/t15?,17-/m1/s1 |
| InChIKey | KXJMADAZFTXYKB-OMOCHNIRSA-N |
| XLogP | 4.13 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|