C20H28O2 — CID 142943737
ethyl 4b,8,8-trimethyl-5,6,7,8a,9,10-hexahydrophenanthrene-2-carboxylate (PubChem CID 142943737) has the molecular formula C20H28O2 and a molecular weight of 300.44 g/mol. Its IUPAC name is ethyl 4b,8,8-trimethyl-5,6,7,8a,9,10-hexahydrophenanthrene-2-carboxylate.
| Compound Name | ethyl 4b,8,8-trimethyl-5,6,7,8a,9,10-hexahydrophenanthrene-2-carboxylate |
|---|---|
| PubChem CID | 142943737 |
| Molecular Formula | C20H28O2 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | ethyl 4b,8,8-trimethyl-5,6,7,8a,9,10-hexahydrophenanthrene-2-carboxylate |
| SMILES | CCOC(=O)c1ccc2c(c1)CCC1C(C)(C)CCCC21C |
| InChI | InChI=1S/C20H28O2/c1-5-22-18(21)15-7-9-16-14(13-15)8-10-17-19(2,3)11-6-12-20(16,17)4/h7,9,13,17H,5-6,8,10-12H2,1-4H3 |
| InChIKey | HMLZFTPYYQAVKG-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |