C23H33NO5 — CID 11069483
methyl (1S,4aS,10aR)-7-(diethylcarbamoyloxy)-6-hydroxy-1,4a-dimethyl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate (PubChem CID 11069483) has the molecular formula C23H33NO5 and a molecular weight of 403.52 g/mol. Its IUPAC name is methyl (1S,4aS,10aR)-7-(diethylcarbamoyloxy)-6-hydroxy-1,4a-dimethyl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate.
| Compound Name | methyl (1S,4aS,10aR)-7-(diethylcarbamoyloxy)-6-hydroxy-1,4a-dimethyl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate |
|---|---|
| PubChem CID | 11069483 |
| Molecular Formula | C23H33NO5 |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.24 |
| IUPAC Name | methyl (1S,4aS,10aR)-7-(diethylcarbamoyloxy)-6-hydroxy-1,4a-dimethyl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate |
| SMILES | CCN(CC)C(=O)Oc1cc2c(cc1O)[C@@]1(C)CCC[C@](C)(C(=O)OC)[C@@H]1CC2 |
| InChI | InChI=1S/C23H33NO5/c1-6-24(7-2)21(27)29-18-13-15-9-10-19-22(3,16(15)14-17(18)25)11-8-12-23(19,4)20(26)28-5/h13-14,19,25H,6-12H2,1-5H3/t19-,22-,23+/m1/s1 |
| InChIKey | KEFGKHWMHXTQAN-PTUXOGIPSA-N |
| XLogP | 4.42 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |