C19H24N2O2 — CID 102014983
methyl (4R,4aR,11bR)-4,11b-dimethyl-2,3,4a,5,6,8-hexahydro-1H-naphtho[1,2-f]benzimidazole-4-carboxylate (PubChem CID 102014983) has the molecular formula C19H24N2O2 and a molecular weight of 312.41 g/mol. Its IUPAC name is methyl (4R,4aR,11bR)-4,11b-dimethyl-2,3,4a,5,6,8-hexahydro-1H-naphtho[1,2-f]benzimidazole-4-carboxylate.
| Compound Name | methyl (4R,4aR,11bR)-4,11b-dimethyl-2,3,4a,5,6,8-hexahydro-1H-naphtho[1,2-f]benzimidazole-4-carboxylate |
|---|---|
| PubChem CID | 102014983 |
| Molecular Formula | C19H24N2O2 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | methyl (4R,4aR,11bR)-4,11b-dimethyl-2,3,4a,5,6,8-hexahydro-1H-naphtho[1,2-f]benzimidazole-4-carboxylate |
| SMILES | COC(=O)[C@]1(C)CCC[C@@]2(C)c3cc4nc[nH]c4cc3CC[C@@H]12 |
| InChI | InChI=1S/C19H24N2O2/c1-18-7-4-8-19(2,17(22)23-3)16(18)6-5-12-9-14-15(10-13(12)18)21-11-20-14/h9-11,16H,4-8H2,1-3H3,(H,20,21)/t16-,18+,19-/m1/s1 |
| InChIKey | MOOKHDOBBSSKJH-NZSAHSFTSA-N |
| XLogP | 3.75 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |