C21H26O3 — CID 54763500
methyl (1S,4aS,10aR)-1,4a-dimethyl-6-prop-2-ynoxy-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate (PubChem CID 54763500) has the molecular formula C21H26O3 and a molecular weight of 326.44 g/mol. Its IUPAC name is methyl (1S,4aS,10aR)-1,4a-dimethyl-6-prop-2-ynoxy-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate.
| Compound Name | methyl (1S,4aS,10aR)-1,4a-dimethyl-6-prop-2-ynoxy-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate |
|---|---|
| PubChem CID | 54763500 |
| Molecular Formula | C21H26O3 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | methyl (1S,4aS,10aR)-1,4a-dimethyl-6-prop-2-ynoxy-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate |
| SMILES | C#CCOc1ccc2c(c1)[C@@]1(C)CCC[C@](C)(C(=O)OC)[C@@H]1CC2 |
| InChI | InChI=1S/C21H26O3/c1-5-13-24-16-9-7-15-8-10-18-20(2,17(15)14-16)11-6-12-21(18,3)19(22)23-4/h1,7,9,14,18H,6,8,10-13H2,2-4H3/t18-,20-,21+/m1/s1 |
| InChIKey | DWIHTXPNUCLVGC-NRSPTQNISA-N |
| XLogP | 3.88 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|