C17H21Cl3O — CID 138514755
[(1R,4aS)-6,7,8-trichloro-1,4a-dimethyl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methanol (PubChem CID 138514755) has the molecular formula C17H21Cl3O and a molecular weight of 347.71 g/mol. Its IUPAC name is [(1R,4aS)-6,7,8-trichloro-1,4a-dimethyl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methanol.
| Compound Name | [(1R,4aS)-6,7,8-trichloro-1,4a-dimethyl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methanol |
|---|---|
| PubChem CID | 138514755 |
| Molecular Formula | C17H21Cl3O |
| Molecular Weight | 347.71 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | [(1R,4aS)-6,7,8-trichloro-1,4a-dimethyl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methanol |
| SMILES | C[C@@]1(CO)CCC[C@]2(C)c3cc(Cl)c(Cl)c(Cl)c3CCC12 |
| InChI | InChI=1S/C17H21Cl3O/c1-16(9-21)6-3-7-17(2)11-8-12(18)15(20)14(19)10(11)4-5-13(16)17/h8,13,21H,3-7,9H2,1-2H3/t13?,16-,17+/m0/s1 |
| InChIKey | MGKPWHSZTTYFAR-ZMKYACIDSA-N |
| XLogP | 5.65 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.71 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|