C18H29IO — CID 66641667
[(1R,4aR,7S)-7-iodo-1,4a,7-trimethyl-3,4,6,8,8a,9,10,10a-octahydro-2H-phenanthren-1-yl]methanol (PubChem CID 66641667) has the molecular formula C18H29IO and a molecular weight of 388.33 g/mol. Its IUPAC name is [(1R,4aR,7S)-7-iodo-1,4a,7-trimethyl-3,4,6,8,8a,9,10,10a-octahydro-2H-phenanthren-1-yl]methanol.
| Compound Name | [(1R,4aR,7S)-7-iodo-1,4a,7-trimethyl-3,4,6,8,8a,9,10,10a-octahydro-2H-phenanthren-1-yl]methanol |
|---|---|
| PubChem CID | 66641667 |
| Molecular Formula | C18H29IO |
| Molecular Weight | 388.33 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | [(1R,4aR,7S)-7-iodo-1,4a,7-trimethyl-3,4,6,8,8a,9,10,10a-octahydro-2H-phenanthren-1-yl]methanol |
| SMILES | C[C@]1(I)CC=C2C(CCC3[C@](C)(CO)CCC[C@@]23C)C1 |
| InChI | InChI=1S/C18H29IO/c1-16(12-20)8-4-9-18(3)14-7-10-17(2,19)11-13(14)5-6-15(16)18/h7,13,15,20H,4-6,8-12H2,1-3H3/t13?,15?,16-,17-,18-/m0/s1 |
| InChIKey | RVJTYQUYJISBCN-PARWYATBSA-N |
| XLogP | 5.12 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.33 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|