C20H34N2O — CID 101102224
(1R,4aR,7S,8aS,10aS)-7-ethyl-1,4a,7-trimethyl-3,4,6,8,8a,9,10,10a-octahydro-2H-phenanthrene-1-carbohydrazide (PubChem CID 101102224) has the molecular formula C20H34N2O and a molecular weight of 318.51 g/mol. Its IUPAC name is (1R,4aR,7S,8aS,10aS)-7-ethyl-1,4a,7-trimethyl-3,4,6,8,8a,9,10,10a-octahydro-2H-phenanthrene-1-carbohydrazide.
| Compound Name | (1R,4aR,7S,8aS,10aS)-7-ethyl-1,4a,7-trimethyl-3,4,6,8,8a,9,10,10a-octahydro-2H-phenanthrene-1-carbohydrazide |
|---|---|
| PubChem CID | 101102224 |
| Molecular Formula | C20H34N2O |
| Molecular Weight | 318.51 g/mol |
| Exact Mass | 318.27 |
| IUPAC Name | (1R,4aR,7S,8aS,10aS)-7-ethyl-1,4a,7-trimethyl-3,4,6,8,8a,9,10,10a-octahydro-2H-phenanthrene-1-carbohydrazide |
| SMILES | CC[C@@]1(C)CC=C2[C@@H](CC[C@@H]3[C@](C)(C(=O)NN)CCC[C@@]23C)C1 |
| InChI | InChI=1S/C20H34N2O/c1-5-18(2)12-9-15-14(13-18)7-8-16-19(15,3)10-6-11-20(16,4)17(23)22-21/h9,14,16H,5-8,10-13,21H2,1-4H3,(H,22,23)/t14-,16-,18-,19-,20+/m0/s1 |
| InChIKey | KXJRRYLEBTWFBL-MGFONVBGSA-N |
| XLogP | 4.34 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.51 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|