C22H36O3 — CID 59076761
2-tritioethyl (1S,4aR,7S)-7-(2-hydroxyethyl)-1,4a,7-trimethyl-3,4,6,8,8a,9,10,10a-octahydro-2H-phenanthrene-1-carboxylate (PubChem CID 59076761) has the molecular formula C22H36O3 and a molecular weight of 350.54 g/mol. Its IUPAC name is 2-tritioethyl (1S,4aR,7S)-7-(2-hydroxyethyl)-1,4a,7-trimethyl-3,4,6,8,8a,9,10,10a-octahydro-2H-phenanthrene-1-carboxylate.
| Compound Name | 2-tritioethyl (1S,4aR,7S)-7-(2-hydroxyethyl)-1,4a,7-trimethyl-3,4,6,8,8a,9,10,10a-octahydro-2H-phenanthrene-1-carboxylate |
|---|---|
| PubChem CID | 59076761 |
| Molecular Formula | C22H36O3 |
| Molecular Weight | 350.54 g/mol |
| Exact Mass | 350.27 |
| IUPAC Name | 2-tritioethyl (1S,4aR,7S)-7-(2-hydroxyethyl)-1,4a,7-trimethyl-3,4,6,8,8a,9,10,10a-octahydro-2H-phenanthrene-1-carboxylate |
| SMILES | [3H]CCOC(=O)[C@@]1(C)CCC[C@@]2(C)C3=CC[C@](C)(CCO)CC3CCC21 |
| InChI | InChI=1S/C22H36O3/c1-5-25-19(24)22(4)11-6-10-21(3)17-9-12-20(2,13-14-23)15-16(17)7-8-18(21)22/h9,16,18,23H,5-8,10-15H2,1-4H3/t16?,18?,20-,21+,22+/m1/s1/i1T |
| InChIKey | ABRHPHFFFQBKRD-DGKIHZMZSA-N |
| XLogP | 4.88 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.54 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|