C30H50O — CID 143402296
1-(7-ethenyl-1,4a,7-trimethyl-3,4,6,8,8a,9,10,10a-octahydro-2H-phenanthren-1-yl)propan-1-one;ethylcyclohexane (PubChem CID 143402296) has the molecular formula C30H50O and a molecular weight of 426.73 g/mol. Its IUPAC name is 1-(7-ethenyl-1,4a,7-trimethyl-3,4,6,8,8a,9,10,10a-octahydro-2H-phenanthren-1-yl)propan-1-one;ethylcyclohexane.
| Compound Name | 1-(7-ethenyl-1,4a,7-trimethyl-3,4,6,8,8a,9,10,10a-octahydro-2H-phenanthren-1-yl)propan-1-one;ethylcyclohexane |
|---|---|
| PubChem CID | 143402296 |
| Molecular Formula | C30H50O |
| Molecular Weight | 426.73 g/mol |
| Exact Mass | 426.39 |
| IUPAC Name | 1-(7-ethenyl-1,4a,7-trimethyl-3,4,6,8,8a,9,10,10a-octahydro-2H-phenanthren-1-yl)propan-1-one;ethylcyclohexane |
| SMILES | C=CC1(C)CC=C2C(CCC3C(C)(C(=O)CC)CCCC23C)C1.CCC1CCCCC1 |
| InChI | InChI=1S/C22H34O.C8H16/c1-6-19(23)22(5)13-8-12-21(4)17-11-14-20(3,7-2)15-16(17)9-10-18(21)22;1-2-8-6-4-3-5-7-8/h7,11,16,18H,2,6,8-10,12-15H2,1,3-5H3;8H,2-7H2,1H3 |
| InChIKey | NGERXTUGRQKUQW-UHFFFAOYSA-N |
| XLogP | 9.08 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.73 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|