C21H34O3S — CID 58330092
[(1R,4aR,7S,8aS,10aS)-7-ethenyl-1,4a,7-trimethyl-3,4,6,8,8a,9,10,10a-octahydro-2H-phenanthren-1-yl]methyl methanesulfonate (PubChem CID 58330092) has the molecular formula C21H34O3S and a molecular weight of 366.57 g/mol. Its IUPAC name is [(1R,4aR,7S,8aS,10aS)-7-ethenyl-1,4a,7-trimethyl-3,4,6,8,8a,9,10,10a-octahydro-2H-phenanthren-1-yl]methyl methanesulfonate.
| Compound Name | [(1R,4aR,7S,8aS,10aS)-7-ethenyl-1,4a,7-trimethyl-3,4,6,8,8a,9,10,10a-octahydro-2H-phenanthren-1-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 58330092 |
| Molecular Formula | C21H34O3S |
| Molecular Weight | 366.57 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | [(1R,4aR,7S,8aS,10aS)-7-ethenyl-1,4a,7-trimethyl-3,4,6,8,8a,9,10,10a-octahydro-2H-phenanthren-1-yl]methyl methanesulfonate |
| SMILES | C=C[C@@]1(C)CC=C2[C@@H](CC[C@@H]3[C@](C)(COS(C)(=O)=O)CCC[C@@]23C)C1 |
| InChI | InChI=1S/C21H34O3S/c1-6-19(2)13-10-17-16(14-19)8-9-18-20(3,15-24-25(5,22)23)11-7-12-21(17,18)4/h6,10,16,18H,1,7-9,11-15H2,2-5H3/t16-,18+,19-,20-,21-/m0/s1 |
| InChIKey | ZGYKMGTUNOOGOS-WTNASJBWSA-N |
| XLogP | 5.10 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.57 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|