C27H44N2O4S — CID 66937956
(7-ethenyl-1,4a,7-trimethyl-3,4,6,8,8a,9,10,10a-octahydro-2H-phenanthren-1-yl)methyl 2-(4-methylsulfonylpiperazin-1-yl)acetate (PubChem CID 66937956) has the molecular formula C27H44N2O4S and a molecular weight of 492.73 g/mol. Its IUPAC name is (7-ethenyl-1,4a,7-trimethyl-3,4,6,8,8a,9,10,10a-octahydro-2H-phenanthren-1-yl)methyl 2-(4-methylsulfonylpiperazin-1-yl)acetate.
| Compound Name | (7-ethenyl-1,4a,7-trimethyl-3,4,6,8,8a,9,10,10a-octahydro-2H-phenanthren-1-yl)methyl 2-(4-methylsulfonylpiperazin-1-yl)acetate |
|---|---|
| PubChem CID | 66937956 |
| Molecular Formula | C27H44N2O4S |
| Molecular Weight | 492.73 g/mol |
| Exact Mass | 492.30 |
| IUPAC Name | (7-ethenyl-1,4a,7-trimethyl-3,4,6,8,8a,9,10,10a-octahydro-2H-phenanthren-1-yl)methyl 2-(4-methylsulfonylpiperazin-1-yl)acetate |
| SMILES | C=CC1(C)CC=C2C(CCC3C(C)(COC(=O)CN4CCN(S(C)(=O)=O)CC4)CCCC23C)C1 |
| InChI | InChI=1S/C27H44N2O4S/c1-6-25(2)13-10-22-21(18-25)8-9-23-26(3,11-7-12-27(22,23)4)20-33-24(30)19-28-14-16-29(17-15-28)34(5,31)32/h6,10,21,23H,1,7-9,11-20H2,2-5H3 |
| InChIKey | FWYNVGOPZLVGEA-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.73 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|