C28H44N2O3 — CID 143402313
[(4aR,7S)-7-ethenyl-1,4a,7-trimethyl-3,4,6,8,8a,9,10,10a-octahydro-2H-phenanthren-1-yl]methyl 2-(4-acetylpiperazin-1-yl)acetate (PubChem CID 143402313) has the molecular formula C28H44N2O3 and a molecular weight of 456.67 g/mol. Its IUPAC name is [(4aR,7S)-7-ethenyl-1,4a,7-trimethyl-3,4,6,8,8a,9,10,10a-octahydro-2H-phenanthren-1-yl]methyl 2-(4-acetylpiperazin-1-yl)acetate.
| Compound Name | [(4aR,7S)-7-ethenyl-1,4a,7-trimethyl-3,4,6,8,8a,9,10,10a-octahydro-2H-phenanthren-1-yl]methyl 2-(4-acetylpiperazin-1-yl)acetate |
|---|---|
| PubChem CID | 143402313 |
| Molecular Formula | C28H44N2O3 |
| Molecular Weight | 456.67 g/mol |
| Exact Mass | 456.34 |
| IUPAC Name | [(4aR,7S)-7-ethenyl-1,4a,7-trimethyl-3,4,6,8,8a,9,10,10a-octahydro-2H-phenanthren-1-yl]methyl 2-(4-acetylpiperazin-1-yl)acetate |
| SMILES | C=C[C@@]1(C)CC=C2C(CCC3C(C)(COC(=O)CN4CCN(C(C)=O)CC4)CCC[C@@]23C)C1 |
| InChI | InChI=1S/C28H44N2O3/c1-6-26(3)13-10-23-22(18-26)8-9-24-27(4,11-7-12-28(23,24)5)20-33-25(32)19-29-14-16-30(17-15-29)21(2)31/h6,10,22,24H,1,7-9,11-20H2,2-5H3/t22?,24?,26-,27?,28-/m0/s1 |
| InChIKey | QXUABCFDDKTVRF-LTOTWWOWSA-N |
| XLogP | 4.83 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.67 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|