C25H40N2O4 — CID 163056952
2-[(7-ethenyl-1,1,4a,7-tetramethyl-3,4,6,8,8a,9,10,10a-octahydro-2H-phenanthren-2-yl)oxy]-N-(2-hydroxyethylcarbamoyl)acetamide (PubChem CID 163056952) has the molecular formula C25H40N2O4 and a molecular weight of 432.61 g/mol. Its IUPAC name is 2-[(7-ethenyl-1,1,4a,7-tetramethyl-3,4,6,8,8a,9,10,10a-octahydro-2H-phenanthren-2-yl)oxy]-N-(2-hydroxyethylcarbamoyl)acetamide.
| Compound Name | 2-[(7-ethenyl-1,1,4a,7-tetramethyl-3,4,6,8,8a,9,10,10a-octahydro-2H-phenanthren-2-yl)oxy]-N-(2-hydroxyethylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 163056952 |
| Molecular Formula | C25H40N2O4 |
| Molecular Weight | 432.61 g/mol |
| Exact Mass | 432.30 |
| IUPAC Name | 2-[(7-ethenyl-1,1,4a,7-tetramethyl-3,4,6,8,8a,9,10,10a-octahydro-2H-phenanthren-2-yl)oxy]-N-(2-hydroxyethylcarbamoyl)acetamide |
| SMILES | C=CC1(C)CC=C2C(CCC3C2(C)CCC(OCC(=O)NC(=O)NCCO)C3(C)C)C1 |
| InChI | InChI=1S/C25H40N2O4/c1-6-24(4)11-9-18-17(15-24)7-8-19-23(2,3)20(10-12-25(18,19)5)31-16-21(29)27-22(30)26-13-14-28/h6,9,17,19-20,28H,1,7-8,10-16H2,2-5H3,(H2,26,27,29,30) |
| InChIKey | ZEUUACHTASJXEP-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.61 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|