C24H35NO5 — CID 58330157
(2S)-2-[[(1R,4aR,7S,8aS,10aS)-7-ethenyl-1,4a,7-trimethyl-3,4,6,8,8a,9,10,10a-octahydro-2H-phenanthrene-1-carbonyl]amino]butanedioic acid (PubChem CID 58330157) has the molecular formula C24H35NO5 and a molecular weight of 417.55 g/mol. Its IUPAC name is (2S)-2-[[(1R,4aR,7S,8aS,10aS)-7-ethenyl-1,4a,7-trimethyl-3,4,6,8,8a,9,10,10a-octahydro-2H-phenanthrene-1-carbonyl]amino]butanedioic acid.
| Compound Name | (2S)-2-[[(1R,4aR,7S,8aS,10aS)-7-ethenyl-1,4a,7-trimethyl-3,4,6,8,8a,9,10,10a-octahydro-2H-phenanthrene-1-carbonyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 58330157 |
| Molecular Formula | C24H35NO5 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.25 |
| IUPAC Name | (2S)-2-[[(1R,4aR,7S,8aS,10aS)-7-ethenyl-1,4a,7-trimethyl-3,4,6,8,8a,9,10,10a-octahydro-2H-phenanthrene-1-carbonyl]amino]butanedioic acid |
| SMILES | C=C[C@@]1(C)CC=C2[C@@H](CC[C@@H]3[C@](C)(C(=O)N[C@@H](CC(=O)O)C(=O)O)CCC[C@@]23C)C1 |
| InChI | InChI=1S/C24H35NO5/c1-5-22(2)12-9-16-15(14-22)7-8-18-23(16,3)10-6-11-24(18,4)21(30)25-17(20(28)29)13-19(26)27/h5,9,15,17-18H,1,6-8,10-14H2,2-4H3,(H,25,30)(H,26,27)(H,28,29)/t15-,17-,18-,22-,23-,24+/m0/s1 |
| InChIKey | RIMNJFZLPMPDBU-XYBCAPHZSA-N |
| XLogP | 4.17 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|