C24H40 — CID 59076768
(2S,4bR,8R)-2-ethenyl-2,4b,8-trimethyl-8-pentyl-3,5,6,7,8a,9,10,10a-octahydro-1H-phenanthrene (PubChem CID 59076768) has the molecular formula C24H40 and a molecular weight of 328.58 g/mol. Its IUPAC name is (2S,4bR,8R)-2-ethenyl-2,4b,8-trimethyl-8-pentyl-3,5,6,7,8a,9,10,10a-octahydro-1H-phenanthrene.
| Compound Name | (2S,4bR,8R)-2-ethenyl-2,4b,8-trimethyl-8-pentyl-3,5,6,7,8a,9,10,10a-octahydro-1H-phenanthrene |
|---|---|
| PubChem CID | 59076768 |
| Molecular Formula | C24H40 |
| Molecular Weight | 328.58 g/mol |
| Exact Mass | 328.31 |
| IUPAC Name | (2S,4bR,8R)-2-ethenyl-2,4b,8-trimethyl-8-pentyl-3,5,6,7,8a,9,10,10a-octahydro-1H-phenanthrene |
| SMILES | C=C[C@@]1(C)CC=C2C(CCC3[C@](C)(CCCCC)CCC[C@@]23C)C1 |
| InChI | InChI=1S/C24H40/c1-6-8-9-14-23(4)15-10-16-24(5)20-13-17-22(3,7-2)18-19(20)11-12-21(23)24/h7,13,19,21H,2,6,8-12,14-18H2,1,3-5H3/t19?,21?,22-,23+,24-/m0/s1 |
| InChIKey | AENBIHMJNVLNJD-DCWCHOGQSA-N |
| XLogP | 7.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.58 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|