C22H34O — CID 143402297
1-(7-ethenyl-1,4a,7-trimethyl-3,4,6,8,8a,9,10,10a-octahydro-2H-phenanthren-1-yl)propan-1-one (PubChem CID 143402297) has the molecular formula C22H34O and a molecular weight of 314.51 g/mol. Its IUPAC name is 1-(7-ethenyl-1,4a,7-trimethyl-3,4,6,8,8a,9,10,10a-octahydro-2H-phenanthren-1-yl)propan-1-one.
| Compound Name | 1-(7-ethenyl-1,4a,7-trimethyl-3,4,6,8,8a,9,10,10a-octahydro-2H-phenanthren-1-yl)propan-1-one |
|---|---|
| PubChem CID | 143402297 |
| Molecular Formula | C22H34O |
| Molecular Weight | 314.51 g/mol |
| Exact Mass | 314.26 |
| IUPAC Name | 1-(7-ethenyl-1,4a,7-trimethyl-3,4,6,8,8a,9,10,10a-octahydro-2H-phenanthren-1-yl)propan-1-one |
| SMILES | C=CC1(C)CC=C2C(CCC3C(C)(C(=O)CC)CCCC23C)C1 |
| InChI | InChI=1S/C22H34O/c1-6-19(23)22(5)13-8-12-21(4)17-11-14-20(3,7-2)15-16(17)9-10-18(21)22/h7,11,16,18H,2,6,8-10,12-15H2,1,3-5H3 |
| InChIKey | JXHLOMKOZQVNDD-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.51 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|