C23H36O — CID 90886051
1-[(1R,4aR,7S,8aS,10aS)-7-ethenyl-1,4a,7-trimethyl-3,4,6,8,8a,9,10,10a-octahydro-2H-phenanthren-1-yl]but-2-en-1-ol (PubChem CID 90886051) has the molecular formula C23H36O and a molecular weight of 328.54 g/mol. Its IUPAC name is 1-[(1R,4aR,7S,8aS,10aS)-7-ethenyl-1,4a,7-trimethyl-3,4,6,8,8a,9,10,10a-octahydro-2H-phenanthren-1-yl]but-2-en-1-ol.
| Compound Name | 1-[(1R,4aR,7S,8aS,10aS)-7-ethenyl-1,4a,7-trimethyl-3,4,6,8,8a,9,10,10a-octahydro-2H-phenanthren-1-yl]but-2-en-1-ol |
|---|---|
| PubChem CID | 90886051 |
| Molecular Formula | C23H36O |
| Molecular Weight | 328.54 g/mol |
| Exact Mass | 328.28 |
| IUPAC Name | 1-[(1R,4aR,7S,8aS,10aS)-7-ethenyl-1,4a,7-trimethyl-3,4,6,8,8a,9,10,10a-octahydro-2H-phenanthren-1-yl]but-2-en-1-ol |
| SMILES | C=C[C@@]1(C)CC=C2[C@@H](CC[C@H]3[C@@]2(C)CCC[C@@]3(C)C(O)C=CC)C1 |
| InChI | InChI=1S/C23H36O/c1-6-9-20(24)23(5)14-8-13-22(4)18-12-15-21(3,7-2)16-17(18)10-11-19(22)23/h6-7,9,12,17,19-20,24H,2,8,10-11,13-16H2,1,3-5H3/t17-,19-,20?,21-,22-,23+/m0/s1 |
| InChIKey | UQZWSLCJYJPMQZ-YGQYEXONSA-N |
| XLogP | 6.06 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.54 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|