C25H43IN2O2 — CID 70793689
[(1R,4aR,5E)-5-[(3R)-3-iodo-3-methylpentylidene]-1,4a-dimethyl-3,4,6,7,8,8a-hexahydro-2H-naphthalen-1-yl]methyl 2-piperazin-1-ylacetate (PubChem CID 70793689) has the molecular formula C25H43IN2O2 and a molecular weight of 530.54 g/mol. Its IUPAC name is [(1R,4aR,5E)-5-[(3R)-3-iodo-3-methylpentylidene]-1,4a-dimethyl-3,4,6,7,8,8a-hexahydro-2H-naphthalen-1-yl]methyl 2-piperazin-1-ylacetate.
| Compound Name | [(1R,4aR,5E)-5-[(3R)-3-iodo-3-methylpentylidene]-1,4a-dimethyl-3,4,6,7,8,8a-hexahydro-2H-naphthalen-1-yl]methyl 2-piperazin-1-ylacetate |
|---|---|
| PubChem CID | 70793689 |
| Molecular Formula | C25H43IN2O2 |
| Molecular Weight | 530.54 g/mol |
| Exact Mass | 530.24 |
| IUPAC Name | [(1R,4aR,5E)-5-[(3R)-3-iodo-3-methylpentylidene]-1,4a-dimethyl-3,4,6,7,8,8a-hexahydro-2H-naphthalen-1-yl]methyl 2-piperazin-1-ylacetate |
| SMILES | CC[C@@](C)(I)C/C=C1\CCCC2[C@](C)(COC(=O)CN3CCNCC3)CCC[C@@]12C |
| InChI | InChI=1S/C25H43IN2O2/c1-5-24(3,26)13-10-20-8-6-9-21-23(2,11-7-12-25(20,21)4)19-30-22(29)18-28-16-14-27-15-17-28/h10,21,27H,5-9,11-19H2,1-4H3/b20-10+/t21?,23-,24+,25-/m0/s1 |
| InChIKey | ZXNBJSOYTCMYAU-MZHJTNLSSA-N |
| XLogP | 5.35 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.54 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|