C23H38INO — CID 66810070
[(1R,4aR,5E)-5-[(3R)-3-iodo-3-methylpentylidene]-1,4a-dimethyl-3,4,6,7,8,8a-hexahydro-2H-naphthalen-1-yl]-pyrrolidin-1-ylmethanone (PubChem CID 66810070) has the molecular formula C23H38INO and a molecular weight of 471.47 g/mol. Its IUPAC name is [(1R,4aR,5E)-5-[(3R)-3-iodo-3-methylpentylidene]-1,4a-dimethyl-3,4,6,7,8,8a-hexahydro-2H-naphthalen-1-yl]-pyrrolidin-1-ylmethanone.
| Compound Name | [(1R,4aR,5E)-5-[(3R)-3-iodo-3-methylpentylidene]-1,4a-dimethyl-3,4,6,7,8,8a-hexahydro-2H-naphthalen-1-yl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 66810070 |
| Molecular Formula | C23H38INO |
| Molecular Weight | 471.47 g/mol |
| Exact Mass | 471.20 |
| IUPAC Name | [(1R,4aR,5E)-5-[(3R)-3-iodo-3-methylpentylidene]-1,4a-dimethyl-3,4,6,7,8,8a-hexahydro-2H-naphthalen-1-yl]-pyrrolidin-1-ylmethanone |
| SMILES | CC[C@@](C)(I)C/C=C1\CCCC2[C@](C)(C(=O)N3CCCC3)CCC[C@@]12C |
| InChI | InChI=1S/C23H38INO/c1-5-21(2,24)15-12-18-10-8-11-19-22(18,3)13-9-14-23(19,4)20(26)25-16-6-7-17-25/h12,19H,5-11,13-17H2,1-4H3/b18-12+/t19?,21-,22+,23-/m1/s1 |
| InChIKey | UJDFMCMUASFRQG-YDAHSNHSSA-N |
| XLogP | 6.53 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.47 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|