C33H51NO5 — CID 134158549
diethyl (4R,5R,9R,10R,12R,13S,14R)-5,9-dimethyl-5-(piperidine-1-carbonyl)-16-propan-2-yltetracyclo[10.2.2.01,10.04,9]hexadec-15-ene-13,14-dicarboxylate (PubChem CID 134158549) has the molecular formula C33H51NO5 and a molecular weight of 541.77 g/mol. Its IUPAC name is diethyl (4R,5R,9R,10R,12R,13S,14R)-5,9-dimethyl-5-(piperidine-1-carbonyl)-16-propan-2-yltetracyclo[10.2.2.01,10.04,9]hexadec-15-ene-13,14-dicarboxylate.
| Compound Name | diethyl (4R,5R,9R,10R,12R,13S,14R)-5,9-dimethyl-5-(piperidine-1-carbonyl)-16-propan-2-yltetracyclo[10.2.2.01,10.04,9]hexadec-15-ene-13,14-dicarboxylate |
|---|---|
| PubChem CID | 134158549 |
| Molecular Formula | C33H51NO5 |
| Molecular Weight | 541.77 g/mol |
| Exact Mass | 541.38 |
| IUPAC Name | diethyl (4R,5R,9R,10R,12R,13S,14R)-5,9-dimethyl-5-(piperidine-1-carbonyl)-16-propan-2-yltetracyclo[10.2.2.01,10.04,9]hexadec-15-ene-13,14-dicarboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@@H](C(=O)OCC)C23C=C(C(C)C)[C@@H]1C[C@@H]2[C@@]1(C)CCC[C@@](C)(C(=O)N2CCCCC2)[C@@H]1CC3 |
| InChI | InChI=1S/C33H51NO5/c1-7-38-28(35)26-22-19-25-31(5)14-12-15-32(6,30(37)34-17-10-9-11-18-34)24(31)13-16-33(25,20-23(22)21(3)4)27(26)29(36)39-8-2/h20-22,24-27H,7-19H2,1-6H3/t22-,24+,25+,26-,27-,31-,32+,33?/m0/s1 |
| InChIKey | UYUAPHMIQDPBTQ-VWLSTSGWSA-N |
| XLogP | 6.18 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.77 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|