C26H38O6 — CID 139076936
(1S,4R,5R,9R,10R,12R,13R,14R)-13-ethoxycarbonyl-5,9-dimethyl-16-propan-2-yltetracyclo[10.2.2.01,10.04,9]hexadec-15-ene-5,14-dicarboxylic acid (PubChem CID 139076936) has the molecular formula C26H38O6 and a molecular weight of 446.58 g/mol. Its IUPAC name is (1S,4R,5R,9R,10R,12R,13R,14R)-13-ethoxycarbonyl-5,9-dimethyl-16-propan-2-yltetracyclo[10.2.2.01,10.04,9]hexadec-15-ene-5,14-dicarboxylic acid.
| Compound Name | (1S,4R,5R,9R,10R,12R,13R,14R)-13-ethoxycarbonyl-5,9-dimethyl-16-propan-2-yltetracyclo[10.2.2.01,10.04,9]hexadec-15-ene-5,14-dicarboxylic acid |
|---|---|
| PubChem CID | 139076936 |
| Molecular Formula | C26H38O6 |
| Molecular Weight | 446.58 g/mol |
| Exact Mass | 446.27 |
| IUPAC Name | (1S,4R,5R,9R,10R,12R,13R,14R)-13-ethoxycarbonyl-5,9-dimethyl-16-propan-2-yltetracyclo[10.2.2.01,10.04,9]hexadec-15-ene-5,14-dicarboxylic acid |
| SMILES | CCOC(=O)[C@H]1[C@@H](C(=O)O)[C@@]23C=C(C(C)C)[C@@H]1C[C@@H]2[C@@]1(C)CCC[C@@](C)(C(=O)O)[C@@H]1CC3 |
| InChI | InChI=1S/C26H38O6/c1-6-32-22(29)19-15-12-18-24(4)9-7-10-25(5,23(30)31)17(24)8-11-26(18,20(19)21(27)28)13-16(15)14(2)3/h13-15,17-20H,6-12H2,1-5H3,(H,27,28)(H,30,31)/t15-,17+,18+,19+,20-,24-,25+,26-/m0/s1 |
| InChIKey | ALLRSRWMWZQMTR-MYKMSFAPSA-N |
| XLogP | 4.78 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.58 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|