C31H39NO4 — CID 163074417
(1R,4S,5R,9S,10R,12R,13S,17R)-5,9-dimethyl-15-(4-methylphenyl)-14,16-dioxo-19-propan-2-yl-15-azapentacyclo[10.5.2.01,10.04,9.013,17]nonadec-18-ene-5-carboxylic acid (PubChem CID 163074417) has the molecular formula C31H39NO4 and a molecular weight of 489.66 g/mol. Its IUPAC name is (1R,4S,5R,9S,10R,12R,13S,17R)-5,9-dimethyl-15-(4-methylphenyl)-14,16-dioxo-19-propan-2-yl-15-azapentacyclo[10.5.2.01,10.04,9.013,17]nonadec-18-ene-5-carboxylic acid.
| Compound Name | (1R,4S,5R,9S,10R,12R,13S,17R)-5,9-dimethyl-15-(4-methylphenyl)-14,16-dioxo-19-propan-2-yl-15-azapentacyclo[10.5.2.01,10.04,9.013,17]nonadec-18-ene-5-carboxylic acid |
|---|---|
| PubChem CID | 163074417 |
| Molecular Formula | C31H39NO4 |
| Molecular Weight | 489.66 g/mol |
| Exact Mass | 489.29 |
| IUPAC Name | (1R,4S,5R,9S,10R,12R,13S,17R)-5,9-dimethyl-15-(4-methylphenyl)-14,16-dioxo-19-propan-2-yl-15-azapentacyclo[10.5.2.01,10.04,9.013,17]nonadec-18-ene-5-carboxylic acid |
| SMILES | Cc1ccc(N2C(=O)[C@@H]3[C@@H](C2=O)[C@]24C=C(C(C)C)[C@@H]3C[C@@H]2[C@]2(C)CCC[C@@](C)(C(=O)O)[C@H]2CC4)cc1 |
| InChI | InChI=1S/C31H39NO4/c1-17(2)21-16-31-14-11-22-29(4,12-6-13-30(22,5)28(35)36)23(31)15-20(21)24-25(31)27(34)32(26(24)33)19-9-7-18(3)8-10-19/h7-10,16-17,20,22-25H,6,11-15H2,1-5H3,(H,35,36)/t20-,22-,23+,24-,25-,29+,30+,31+/m0/s1 |
| InChIKey | YAHGOSRWKWIBRM-UYUCUDGNSA-N |
| XLogP | 6.01 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.66 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|